C30H31N5O2 — CID 66750202
N,N-bis[[2-[(2S)-pyrrolidin-2-yl]-1,3-benzoxazol-5-yl]methyl]aniline (PubChem CID 66750202) has the molecular formula C30H31N5O2 and a molecular weight of 493.61 g/mol. Its IUPAC name is N,N-bis[[2-[(2S)-pyrrolidin-2-yl]-1,3-benzoxazol-5-yl]methyl]aniline.
| Compound Name | N,N-bis[[2-[(2S)-pyrrolidin-2-yl]-1,3-benzoxazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 66750202 |
| Molecular Formula | C30H31N5O2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | N,N-bis[[2-[(2S)-pyrrolidin-2-yl]-1,3-benzoxazol-5-yl]methyl]aniline |
| SMILES | c1ccc(N(Cc2ccc3oc([C@@H]4CCCN4)nc3c2)Cc2ccc3oc([C@@H]4CCCN4)nc3c2)cc1 |
| InChI | InChI=1S/C30H31N5O2/c1-2-6-22(7-3-1)35(18-20-10-12-27-25(16-20)33-29(36-27)23-8-4-14-31-23)19-21-11-13-28-26(17-21)34-30(37-28)24-9-5-15-32-24/h1-3,6-7,10-13,16-17,23-24,31-32H,4-5,8-9,14-15,18-19H2/t23-,24-/m0/s1 |
| InChIKey | QSXISJVLGNXVGH-ZEQRLZLVSA-N |
| XLogP | 6.02 |
| TPSA | 79.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |