C19H22N2O6S — CID 66750756
5-[6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]-2,2-dimethylpentanoic acid (PubChem CID 66750756) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is 5-[6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 66750756 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 5-[6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]-2,2-dimethylpentanoic acid |
| SMILES | CC(C)(CCCc1ccc2cc(O)c(N3CC(=O)NS3(=O)=O)cc2c1)C(=O)O |
| InChI | InChI=1S/C19H22N2O6S/c1-19(2,18(24)25)7-3-4-12-5-6-13-10-16(22)15(9-14(13)8-12)21-11-17(23)20-28(21,26)27/h5-6,8-10,22H,3-4,7,11H2,1-2H3,(H,20,23)(H,24,25) |
| InChIKey | ODJDBCMBLUOXBM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |