About 2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole
2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole (PubChem CID 66750908) has the molecular formula C20H18IN3O
and a molecular weight of 443.29 g/mol. Its IUPAC name is 2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole.
Molecular Properties
| Compound Name | 2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole |
| PubChem CID | 66750908 |
| Molecular Formula | C20H18IN3O |
| Molecular Weight | 443.29 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole |
| SMILES | COc1cc(=C2C=c3ccccc3=N2)[nH]c1=Cc1[nH]c(C)c(I)c1C |
| InChI | InChI=1S/C20H18IN3O/c1-11-15(22-12(2)20(11)21)9-18-19(25-3)10-17(24-18)16-8-13-6-4-5-7-14(13)23-16/h4-10,22,24H,1-3H3 |
| InChIKey | MPSGJDFYHMNXNO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole?
The IUPAC name of 2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole (CID 66750908) is 2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole.
What is the SMILES notation for 2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole?
The canonical SMILES for 2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole is COc1cc(=C2C=c3ccccc3=N2)[nH]c1=Cc1[nH]c(C)c(I)c1C.
What is the InChIKey of 2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole?
The InChIKey is MPSGJDFYHMNXNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18IN3O/c1-11-15(22-12(2)20(11)21)9-18-19(25-3)10-17(24-18)16-8-13-6-4-5-7-14(13)23-16/h4-10,22,24H,1-3H3.
What are the key properties of 2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole?
2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole has a molecular weight of 443.29 g/mol, XLogP of 1.62, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(4-iodo-3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-4-methoxypyrrol-2-ylidene]indole is sourced from PubChem (CID 66750908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).