About methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate
methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate (PubChem CID 66751820) has the molecular formula C14H15N3O5S
and a molecular weight of 337.36 g/mol. Its IUPAC name is methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate |
| PubChem CID | 66751820 |
| Molecular Formula | C14H15N3O5S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)CCC(N2Cc3c(csc3N)C2=O)C1=O |
| InChI | InChI=1S/C14H15N3O5S/c1-22-11(19)5-17-10(18)3-2-9(14(17)21)16-4-7-8(13(16)20)6-23-12(7)15/h6,9H,2-5,15H2,1H3 |
| InChIKey | LIGMVAURSLMEHK-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate?
The IUPAC name of methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate (CID 66751820) is methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate.
What is the SMILES notation for methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate?
The canonical SMILES for methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate is COC(=O)CN1C(=O)CCC(N2Cc3c(csc3N)C2=O)C1=O.
What is the InChIKey of methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate?
The InChIKey is LIGMVAURSLMEHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O5S/c1-22-11(19)5-17-10(18)3-2-9(14(17)21)16-4-7-8(13(16)20)6-23-12(7)15/h6,9H,2-5,15H2,1H3.
What are the key properties of methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate?
methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate has a molecular weight of 337.36 g/mol, XLogP of -0.02, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]acetate is sourced from PubChem (CID 66751820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).