About 3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione
3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione (PubChem CID 66751913) has the molecular formula C17H16N2O3S2
and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione.
Molecular Properties
| Compound Name | 3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione |
| PubChem CID | 66751913 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cscc3C2=O)C(=O)N1CCc1cccs1 |
| InChI | InChI=1S/C17H16N2O3S2/c20-15-4-3-14(19-8-11-9-23-10-13(11)16(19)21)17(22)18(15)6-5-12-2-1-7-24-12/h1-2,7,9-10,14H,3-6,8H2 |
| InChIKey | NPYIAQXUYIWXMI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione?
The IUPAC name of 3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione (CID 66751913) is 3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione.
What is the SMILES notation for 3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione?
The canonical SMILES for 3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione is O=C1CCC(N2Cc3cscc3C2=O)C(=O)N1CCc1cccs1.
What is the InChIKey of 3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione?
The InChIKey is NPYIAQXUYIWXMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O3S2/c20-15-4-3-14(19-8-11-9-23-10-13(11)16(19)21)17(22)18(15)6-5-12-2-1-7-24-12/h1-2,7,9-10,14H,3-6,8H2.
What are the key properties of 3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione?
3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione has a molecular weight of 360.46 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-oxo-6H-thieno[3,4-c]pyrrol-5-yl)-1-(2-thiophen-2-ylethyl)piperidine-2,6-dione is sourced from PubChem (CID 66751913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).