C27H35N3O3 — CID 66752041
(7R)-7-(3,4-dimethoxyphenyl)-1-(4-ethylpiperazin-1-yl)-7,8,9,10,11,11a-hexahydroazepino[1,2-b]isoindol-5-one (PubChem CID 66752041) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is (7R)-7-(3,4-dimethoxyphenyl)-1-(4-ethylpiperazin-1-yl)-7,8,9,10,11,11a-hexahydroazepino[1,2-b]isoindol-5-one.
| Compound Name | (7R)-7-(3,4-dimethoxyphenyl)-1-(4-ethylpiperazin-1-yl)-7,8,9,10,11,11a-hexahydroazepino[1,2-b]isoindol-5-one |
|---|---|
| PubChem CID | 66752041 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | (7R)-7-(3,4-dimethoxyphenyl)-1-(4-ethylpiperazin-1-yl)-7,8,9,10,11,11a-hexahydroazepino[1,2-b]isoindol-5-one |
| SMILES | CCN1CCN(c2cccc3c2C2CCCC[C@H](c4ccc(OC)c(OC)c4)N2C3=O)CC1 |
| InChI | InChI=1S/C27H35N3O3/c1-4-28-14-16-29(17-15-28)22-11-7-8-20-26(22)23-10-6-5-9-21(30(23)27(20)31)19-12-13-24(32-2)25(18-19)33-3/h7-8,11-13,18,21,23H,4-6,9-10,14-17H2,1-3H3/t21-,23?/m1/s1 |
| InChIKey | WAKCRMRPYXATKS-FKHAVUOCSA-N |
| XLogP | 4.66 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |