About 4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine
4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine (PubChem CID 66752999) has the molecular formula C16H16Cl2N2O
and a molecular weight of 323.22 g/mol. Its IUPAC name is 4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine.
Molecular Properties
| Compound Name | 4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine |
| PubChem CID | 66752999 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine |
| SMILES | Clc1cccc(Cl)c1O[C@H](c1ccncc1)C1CCNC1 |
| InChI | InChI=1S/C16H16Cl2N2O/c17-13-2-1-3-14(18)16(13)21-15(12-6-9-20-10-12)11-4-7-19-8-5-11/h1-5,7-8,12,15,20H,6,9-10H2/t12?,15-/m1/s1 |
| InChIKey | QBGOOPKOGDIXOG-WPZCJLIBSA-N |
| XLogP | 4.12 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine?
The IUPAC name of 4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine (CID 66752999) is 4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine.
What is the SMILES notation for 4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine?
The canonical SMILES for 4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine is Clc1cccc(Cl)c1O[C@H](c1ccncc1)C1CCNC1.
What is the InChIKey of 4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine?
The InChIKey is QBGOOPKOGDIXOG-WPZCJLIBSA-N. The full InChI is InChI=1S/C16H16Cl2N2O/c17-13-2-1-3-14(18)16(13)21-15(12-6-9-20-10-12)11-4-7-19-8-5-11/h1-5,7-8,12,15,20H,6,9-10H2/t12?,15-/m1/s1.
What are the key properties of 4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine?
4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine has a molecular weight of 323.22 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(S)-(2,6-dichlorophenoxy)-pyrrolidin-3-ylmethyl]pyridine is sourced from PubChem (CID 66752999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).