About 6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one
6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 66753571) has the molecular formula C7H5IN2OS
and a molecular weight of 292.10 g/mol. Its IUPAC name is 6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| PubChem CID | 66753571 |
| Molecular Formula | C7H5IN2OS |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 291.92 |
| IUPAC Name | 6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cc1nc2sccn2c(=O)c1I |
| InChI | InChI=1S/C7H5IN2OS/c1-4-5(8)6(11)10-2-3-12-7(10)9-4/h2-3H,1H3 |
| InChIKey | SDVBQDFJYGFALT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The IUPAC name of 6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CID 66753571) is 6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
What is the SMILES notation for 6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The canonical SMILES for 6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is Cc1nc2sccn2c(=O)c1I.
What is the InChIKey of 6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The InChIKey is SDVBQDFJYGFALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5IN2OS/c1-4-5(8)6(11)10-2-3-12-7(10)9-4/h2-3H,1H3.
What are the key properties of 6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one has a molecular weight of 292.10 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is sourced from PubChem (CID 66753571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).