About 1-acetyl-2,3-dihydropyrrole-2-carboxamide
1-acetyl-2,3-dihydropyrrole-2-carboxamide (PubChem CID 66755761) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 1-acetyl-2,3-dihydropyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 1-acetyl-2,3-dihydropyrrole-2-carboxamide |
| PubChem CID | 66755761 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 1-acetyl-2,3-dihydropyrrole-2-carboxamide |
| SMILES | CC(=O)N1C=CCC1C(N)=O |
| InChI | InChI=1S/C7H10N2O2/c1-5(10)9-4-2-3-6(9)7(8)11/h2,4,6H,3H2,1H3,(H2,8,11) |
| InChIKey | HKZBCXDWWAAQFE-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-acetyl-2,3-dihydropyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-2,3-dihydropyrrole-2-carboxamide?
The IUPAC name of 1-acetyl-2,3-dihydropyrrole-2-carboxamide (CID 66755761) is 1-acetyl-2,3-dihydropyrrole-2-carboxamide.
What is the SMILES notation for 1-acetyl-2,3-dihydropyrrole-2-carboxamide?
The canonical SMILES for 1-acetyl-2,3-dihydropyrrole-2-carboxamide is CC(=O)N1C=CCC1C(N)=O.
What is the InChIKey of 1-acetyl-2,3-dihydropyrrole-2-carboxamide?
The InChIKey is HKZBCXDWWAAQFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-5(10)9-4-2-3-6(9)7(8)11/h2,4,6H,3H2,1H3,(H2,8,11).
What are the key properties of 1-acetyl-2,3-dihydropyrrole-2-carboxamide?
1-acetyl-2,3-dihydropyrrole-2-carboxamide has a molecular weight of 154.17 g/mol, XLogP of -0.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-2,3-dihydropyrrole-2-carboxamide is sourced from PubChem (CID 66755761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).