2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid

C7H9N3O4 — CID 66755924

IUPAC2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid
SMILESCn1c(=O)[nH]cc(NCC(=O)O)c1=O
InChIInChI=1S/C7H9N3O4/c1-10-6(13)4(2-9-7(10)14)8-3-5(11)12/h2,8H,3H2,1H3,(H,9,14)(H,11,12)
InChIKeyPJEZCSZIIFEYCO-UHFFFAOYSA-N
MW199.17 g/mol
LogP-1.43
Rot. Bonds3

About 2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid

2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid (PubChem CID 66755924) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is 2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid.

Molecular Properties

Compound Name2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid
PubChem CID66755924
Molecular FormulaC7H9N3O4
Molecular Weight199.17 g/mol
Exact Mass199.06
IUPAC Name2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid
SMILESCn1c(=O)[nH]cc(NCC(=O)O)c1=O
InChIInChI=1S/C7H9N3O4/c1-10-6(13)4(2-9-7(10)14)8-3-5(11)12/h2,8H,3H2,1H3,(H,9,14)(H,11,12)
InChIKeyPJEZCSZIIFEYCO-UHFFFAOYSA-N
XLogP-1.43
TPSA104.19 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.17
LogP ≤ 5-1.43
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid?
The IUPAC name of 2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid (CID 66755924) is 2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid.
What is the SMILES notation for 2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid?
The canonical SMILES for 2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid is Cn1c(=O)[nH]cc(NCC(=O)O)c1=O.
What is the InChIKey of 2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid?
The InChIKey is PJEZCSZIIFEYCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O4/c1-10-6(13)4(2-9-7(10)14)8-3-5(11)12/h2,8H,3H2,1H3,(H,9,14)(H,11,12).
What are the key properties of 2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid?
2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid has a molecular weight of 199.17 g/mol, XLogP of -1.43, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid is sourced from PubChem (CID 66755924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).