C20H23N3O8S2 — CID 66756526
[5-[[2-(methanesulfonamido)-3,5-dimethylphenyl]methyl]-2-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl] methyl carbonate (PubChem CID 66756526) has the molecular formula C20H23N3O8S2 and a molecular weight of 497.55 g/mol. Its IUPAC name is [5-[[2-(methanesulfonamido)-3,5-dimethylphenyl]methyl]-2-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl] methyl carbonate.
| Compound Name | [5-[[2-(methanesulfonamido)-3,5-dimethylphenyl]methyl]-2-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl] methyl carbonate |
|---|---|
| PubChem CID | 66756526 |
| Molecular Formula | C20H23N3O8S2 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | [5-[[2-(methanesulfonamido)-3,5-dimethylphenyl]methyl]-2-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)phenyl] methyl carbonate |
| SMILES | COC(=O)Oc1cc(Cc2cc(C)cc(C)c2NS(C)(=O)=O)ccc1N1CC(=O)NS1(=O)=O |
| InChI | InChI=1S/C20H23N3O8S2/c1-12-7-13(2)19(22-32(4,26)27)15(8-12)9-14-5-6-16(17(10-14)31-20(25)30-3)23-11-18(24)21-33(23,28)29/h5-8,10,22H,9,11H2,1-4H3,(H,21,24) |
| InChIKey | JDUZBWAXXZJZFB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|