C21H24Cl2N2O6 — CID 66756644
tert-butyl 4-[4-(2,6-dichlorophenyl)-1,3-oxazol-2-yl]-4-hydroxy-3-(prop-2-enoxycarbonylamino)butanoate (PubChem CID 66756644) has the molecular formula C21H24Cl2N2O6 and a molecular weight of 471.34 g/mol. Its IUPAC name is tert-butyl 4-[4-(2,6-dichlorophenyl)-1,3-oxazol-2-yl]-4-hydroxy-3-(prop-2-enoxycarbonylamino)butanoate.
| Compound Name | tert-butyl 4-[4-(2,6-dichlorophenyl)-1,3-oxazol-2-yl]-4-hydroxy-3-(prop-2-enoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 66756644 |
| Molecular Formula | C21H24Cl2N2O6 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | tert-butyl 4-[4-(2,6-dichlorophenyl)-1,3-oxazol-2-yl]-4-hydroxy-3-(prop-2-enoxycarbonylamino)butanoate |
| SMILES | C=CCOC(=O)NC(CC(=O)OC(C)(C)C)C(O)c1nc(-c2c(Cl)cccc2Cl)co1 |
| InChI | InChI=1S/C21H24Cl2N2O6/c1-5-9-29-20(28)25-14(10-16(26)31-21(2,3)4)18(27)19-24-15(11-30-19)17-12(22)7-6-8-13(17)23/h5-8,11,14,18,27H,1,9-10H2,2-4H3,(H,25,28) |
| InChIKey | WGWIOIHHHCNGSN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|