C15H14Cl2N2O6 — CID 66756721
4-(5,7-dichloro-1,3-benzoxazol-2-yl)-4-hydroxy-3-(prop-2-enoxycarbonylamino)butanoic acid (PubChem CID 66756721) has the molecular formula C15H14Cl2N2O6 and a molecular weight of 389.19 g/mol. Its IUPAC name is 4-(5,7-dichloro-1,3-benzoxazol-2-yl)-4-hydroxy-3-(prop-2-enoxycarbonylamino)butanoic acid.
| Compound Name | 4-(5,7-dichloro-1,3-benzoxazol-2-yl)-4-hydroxy-3-(prop-2-enoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 66756721 |
| Molecular Formula | C15H14Cl2N2O6 |
| Molecular Weight | 389.19 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 4-(5,7-dichloro-1,3-benzoxazol-2-yl)-4-hydroxy-3-(prop-2-enoxycarbonylamino)butanoic acid |
| SMILES | C=CCOC(=O)NC(CC(=O)O)C(O)c1nc2cc(Cl)cc(Cl)c2o1 |
| InChI | InChI=1S/C15H14Cl2N2O6/c1-2-3-24-15(23)19-9(6-11(20)21)12(22)14-18-10-5-7(16)4-8(17)13(10)25-14/h2,4-5,9,12,22H,1,3,6H2,(H,19,23)(H,20,21) |
| InChIKey | YTHOAOZHSPPRNT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|