C14H22N2 — CID 66756928
3-[(1R,2R)-2-(5,5-dimethylhex-1-ynyl)cyclopropyl]-1,2-dihydroimidazole (PubChem CID 66756928) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 3-[(1R,2R)-2-(5,5-dimethylhex-1-ynyl)cyclopropyl]-1,2-dihydroimidazole.
| Compound Name | 3-[(1R,2R)-2-(5,5-dimethylhex-1-ynyl)cyclopropyl]-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 66756928 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 3-[(1R,2R)-2-(5,5-dimethylhex-1-ynyl)cyclopropyl]-1,2-dihydroimidazole |
| SMILES | CC(C)(C)CCC#C[C@H]1C[C@H]1N1C=CNC1 |
| InChI | InChI=1S/C14H22N2/c1-14(2,3)7-5-4-6-12-10-13(12)16-9-8-15-11-16/h8-9,12-13,15H,5,7,10-11H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | JIDULRGZSTUJTR-QWHCGFSZSA-N |
| XLogP | 2.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|