About 1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol
1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol (PubChem CID 66757055) has the molecular formula C15H24OSi
and a molecular weight of 248.44 g/mol. Its IUPAC name is 1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol.
Molecular Properties
| Compound Name | 1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol |
| PubChem CID | 66757055 |
| Molecular Formula | C15H24OSi |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol |
| SMILES | CC1=C(CC(O)C#C[Si](C)(C)C)[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C15H24OSi/c1-11-12-5-6-13(9-12)15(11)10-14(16)7-8-17(2,3)4/h12-14,16H,5-6,9-10H2,1-4H3/t12-,13+,14?/m0/s1 |
| InChIKey | ZJKVJHDOBVYAKB-WLDKUNSKSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol?
The IUPAC name of 1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol (CID 66757055) is 1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol.
What is the SMILES notation for 1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol?
The canonical SMILES for 1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol is CC1=C(CC(O)C#C[Si](C)(C)C)[C@@H]2CC[C@H]1C2.
What is the InChIKey of 1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol?
The InChIKey is ZJKVJHDOBVYAKB-WLDKUNSKSA-N. The full InChI is InChI=1S/C15H24OSi/c1-11-12-5-6-13(9-12)15(11)10-14(16)7-8-17(2,3)4/h12-14,16H,5-6,9-10H2,1-4H3/t12-,13+,14?/m0/s1.
What are the key properties of 1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol?
1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol has a molecular weight of 248.44 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,4S)-3-methyl-2-bicyclo[2.2.1]hept-2-enyl]-4-trimethylsilylbut-3-yn-2-ol is sourced from PubChem (CID 66757055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).