About CID 66757134
CID 66757134 (PubChem CID 66757134) has the molecular formula C18H26BO2Si2
and a molecular weight of 341.39 g/mol.
Molecular Properties
| Compound Name | CID 66757134 |
| PubChem CID | 66757134 |
| Molecular Formula | C18H26BO2Si2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)c1cccc(O[B]Oc2cccc([Si](C)(C)C)c2)c1 |
| InChI | InChI=1S/C18H26BO2Si2/c1-22(2,3)17-11-7-9-15(13-17)20-19-21-16-10-8-12-18(14-16)23(4,5)6/h7-14H,1-6H3 |
| InChIKey | ILESAKUCUZJLMF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66757134 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66757134?
The IUPAC name of CID 66757134 (CID 66757134) is not available.
What is the SMILES notation for CID 66757134?
The canonical SMILES for CID 66757134 is C[Si](C)(C)c1cccc(O[B]Oc2cccc([Si](C)(C)C)c2)c1.
What is the InChIKey of CID 66757134?
The InChIKey is ILESAKUCUZJLMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26BO2Si2/c1-22(2,3)17-11-7-9-15(13-17)20-19-21-16-10-8-12-18(14-16)23(4,5)6/h7-14H,1-6H3.
What are the key properties of CID 66757134?
CID 66757134 has a molecular weight of 341.39 g/mol, XLogP of 3.77, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66757134 is sourced from PubChem (CID 66757134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).