About but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile
but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile (PubChem CID 66757338) has the molecular formula C16H18N4O4
and a molecular weight of 330.34 g/mol. Its IUPAC name is but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile |
| PubChem CID | 66757338 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(N2CCC3CNC3C2)c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C12H14N4.C4H4O4/c13-4-9-3-11(7-14-5-9)16-2-1-10-6-15-12(10)8-16;5-3(6)1-2-4(7)8/h3,5,7,10,12,15H,1-2,6,8H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | RCXHVENAKOVQKN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 126.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile?
The IUPAC name of but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile (CID 66757338) is but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile.
What is the SMILES notation for but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile?
The canonical SMILES for but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile is N#Cc1cncc(N2CCC3CNC3C2)c1.O=C(O)C=CC(=O)O.
What is the InChIKey of but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile?
The InChIKey is RCXHVENAKOVQKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4.C4H4O4/c13-4-9-3-11(7-14-5-9)16-2-1-10-6-15-12(10)8-16;5-3(6)1-2-4(7)8/h3,5,7,10,12,15H,1-2,6,8H2;1-2H,(H,5,6)(H,7,8).
What are the key properties of but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile?
but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile has a molecular weight of 330.34 g/mol, XLogP of 0.46, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioic acid;5-(3,8-diazabicyclo[4.2.0]octan-3-yl)pyridine-3-carbonitrile is sourced from PubChem (CID 66757338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).