C17H22N4O2 — CID 66757431
(3aR,6aR)-2-tert-butyl-1-(5-cyano-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid (PubChem CID 66757431) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is (3aR,6aR)-2-tert-butyl-1-(5-cyano-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid.
| Compound Name | (3aR,6aR)-2-tert-butyl-1-(5-cyano-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 66757431 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (3aR,6aR)-2-tert-butyl-1-(5-cyano-3-pyridinyl)-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid |
| SMILES | CC(C)(C)C1C[C@@H]2CN(C(=O)O)C[C@@H]2N1c1cncc(C#N)c1 |
| InChI | InChI=1S/C17H22N4O2/c1-17(2,3)15-5-12-9-20(16(22)23)10-14(12)21(15)13-4-11(6-18)7-19-8-13/h4,7-8,12,14-15H,5,9-10H2,1-3H3,(H,22,23)/t12-,14+,15?/m1/s1 |
| InChIKey | RTEKQVSLIAPWNH-JEIKQXNFSA-N |
| XLogP | 2.56 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |