C13H15N3O — CID 66757582
6-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]furo[3,2-b]pyridine (PubChem CID 66757582) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 6-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]furo[3,2-b]pyridine.
| Compound Name | 6-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 66757582 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 6-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]furo[3,2-b]pyridine |
| SMILES | c1cc2ncc(N3C[C@H]4CNC[C@H]4C3)cc2o1 |
| InChI | InChI=1S/C13H15N3O/c1-2-17-13-3-11(6-15-12(1)13)16-7-9-4-14-5-10(9)8-16/h1-3,6,9-10,14H,4-5,7-8H2/t9-,10+ |
| InChIKey | BYSSTXQZDLJWLA-AOOOYVTPSA-N |
| XLogP | 1.48 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |