About N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid
N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid (PubChem CID 66758167) has the molecular formula C37H37BN2O2
and a molecular weight of 552.53 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid.
Molecular Properties
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid |
| PubChem CID | 66758167 |
| Molecular Formula | C37H37BN2O2 |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid |
| SMILES | CC(C)c1cccc(C(C)C)c1Nc1cccc(-c2cccc3ccccc23)n1.OB(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H28N2.C10H9BO2/c1-18(2)21-13-8-14-22(19(3)4)27(21)29-26-17-9-16-25(28-26)24-15-7-11-20-10-5-6-12-23(20)24;12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h5-19H,1-4H3,(H,28,29);1-7,12-13H |
| InChIKey | OLMFTTOETYEGGB-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid?
The IUPAC name of N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid (CID 66758167) is N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid.
What is the SMILES notation for N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid?
The canonical SMILES for N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid is CC(C)c1cccc(C(C)C)c1Nc1cccc(-c2cccc3ccccc23)n1.OB(O)c1cccc2ccccc12.
What is the InChIKey of N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid?
The InChIKey is OLMFTTOETYEGGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N2.C10H9BO2/c1-18(2)21-13-8-14-22(19(3)4)27(21)29-26-17-9-16-25(28-26)24-15-7-11-20-10-5-6-12-23(20)24;12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h5-19H,1-4H3,(H,28,29);1-7,12-13H.
What are the key properties of N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid?
N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid has a molecular weight of 552.53 g/mol, XLogP of 8.41, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,6-di(propan-2-yl)phenyl]-6-naphthalen-1-ylpyridin-2-amine;naphthalen-1-ylboronic acid is sourced from PubChem (CID 66758167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).