About 4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine
4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine (PubChem CID 66758410) has the molecular formula C10H13N5S
and a molecular weight of 235.32 g/mol. Its IUPAC name is 4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine.
Molecular Properties
| Compound Name | 4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine |
| PubChem CID | 66758410 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine |
| SMILES | NC1CN(c2ncc3ccsc3n2)CCN1 |
| InChI | InChI=1S/C10H13N5S/c11-8-6-15(3-2-12-8)10-13-5-7-1-4-16-9(7)14-10/h1,4-5,8,12H,2-3,6,11H2 |
| InChIKey | PILFPZMUDJMYMY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine?
The IUPAC name of 4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine (CID 66758410) is 4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine.
What is the SMILES notation for 4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine?
The canonical SMILES for 4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine is NC1CN(c2ncc3ccsc3n2)CCN1.
What is the InChIKey of 4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine?
The InChIKey is PILFPZMUDJMYMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5S/c11-8-6-15(3-2-12-8)10-13-5-7-1-4-16-9(7)14-10/h1,4-5,8,12H,2-3,6,11H2.
What are the key properties of 4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine?
4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine has a molecular weight of 235.32 g/mol, XLogP of 0.39, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thieno[2,3-d]pyrimidin-2-ylpiperazin-2-amine is sourced from PubChem (CID 66758410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).