About 5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione
5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione (PubChem CID 66758452) has the molecular formula C11H7ClN4S2
and a molecular weight of 294.79 g/mol. Its IUPAC name is 5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione.
Molecular Properties
| Compound Name | 5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione |
| PubChem CID | 66758452 |
| Molecular Formula | C11H7ClN4S2 |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione |
| SMILES | Nc1nc2sc(-c3ccc(Cl)cc3)nc2c(=S)[nH]1 |
| InChI | InChI=1S/C11H7ClN4S2/c12-6-3-1-5(2-4-6)9-14-7-8(17)15-11(13)16-10(7)18-9/h1-4H,(H3,13,15,16,17) |
| InChIKey | ZLWYNENBUKZPMJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione?
The IUPAC name of 5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione (CID 66758452) is 5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione.
What is the SMILES notation for 5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione?
The canonical SMILES for 5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione is Nc1nc2sc(-c3ccc(Cl)cc3)nc2c(=S)[nH]1.
What is the InChIKey of 5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione?
The InChIKey is ZLWYNENBUKZPMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClN4S2/c12-6-3-1-5(2-4-6)9-14-7-8(17)15-11(13)16-10(7)18-9/h1-4H,(H3,13,15,16,17).
What are the key properties of 5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione?
5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione has a molecular weight of 294.79 g/mol, XLogP of 3.65, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(4-chlorophenyl)-6H-[1,3]thiazolo[5,4-d]pyrimidine-7-thione is sourced from PubChem (CID 66758452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).