About 2,9-dimethyl-1,7-phenanthroline
2,9-dimethyl-1,7-phenanthroline (PubChem CID 66758842) has the molecular formula C14H12N2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2,9-dimethyl-1,7-phenanthroline.
Molecular Properties
| Compound Name | 2,9-dimethyl-1,7-phenanthroline |
| PubChem CID | 66758842 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2,9-dimethyl-1,7-phenanthroline |
| SMILES | Cc1cnc2ccc3ccc(C)nc3c2c1 |
| InChI | InChI=1S/C14H12N2/c1-9-7-12-13(15-8-9)6-5-11-4-3-10(2)16-14(11)12/h3-8H,1-2H3 |
| InChIKey | HOSUSOUFXMLERB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2,9-dimethyl-1,7-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-dimethyl-1,7-phenanthroline?
The IUPAC name of 2,9-dimethyl-1,7-phenanthroline (CID 66758842) is 2,9-dimethyl-1,7-phenanthroline.
What is the SMILES notation for 2,9-dimethyl-1,7-phenanthroline?
The canonical SMILES for 2,9-dimethyl-1,7-phenanthroline is Cc1cnc2ccc3ccc(C)nc3c2c1.
What is the InChIKey of 2,9-dimethyl-1,7-phenanthroline?
The InChIKey is HOSUSOUFXMLERB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2/c1-9-7-12-13(15-8-9)6-5-11-4-3-10(2)16-14(11)12/h3-8H,1-2H3.
What are the key properties of 2,9-dimethyl-1,7-phenanthroline?
2,9-dimethyl-1,7-phenanthroline has a molecular weight of 208.26 g/mol, XLogP of 3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-dimethyl-1,7-phenanthroline is sourced from PubChem (CID 66758842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).