About 5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine
5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine (PubChem CID 66758850) has the molecular formula C30H25FN4O2
and a molecular weight of 492.55 g/mol. Its IUPAC name is 5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine |
| PubChem CID | 66758850 |
| Molecular Formula | C30H25FN4O2 |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1ccc(-c2ccccc2)cc1Nc1ncc(F)c(Nc2cc(-c3ccccc3)ccc2OC)n1 |
| InChI | InChI=1S/C30H25FN4O2/c1-36-27-15-13-22(20-9-5-3-6-10-20)17-25(27)33-29-24(31)19-32-30(35-29)34-26-18-23(14-16-28(26)37-2)21-11-7-4-8-12-21/h3-19H,1-2H3,(H2,32,33,34,35) |
| InChIKey | IXDSJWSUBIIELL-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine?
The IUPAC name of 5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine (CID 66758850) is 5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine?
The canonical SMILES for 5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine is COc1ccc(-c2ccccc2)cc1Nc1ncc(F)c(Nc2cc(-c3ccccc3)ccc2OC)n1.
What is the InChIKey of 5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine?
The InChIKey is IXDSJWSUBIIELL-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H25FN4O2/c1-36-27-15-13-22(20-9-5-3-6-10-20)17-25(27)33-29-24(31)19-32-30(35-29)34-26-18-23(14-16-28(26)37-2)21-11-7-4-8-12-21/h3-19H,1-2H3,(H2,32,33,34,35).
What are the key properties of 5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine?
5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine has a molecular weight of 492.55 g/mol, XLogP of 7.45, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-N,4-N-bis(2-methoxy-5-phenylphenyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 66758850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).