About 5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran
5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran (PubChem CID 66759547) has the molecular formula C18H19BrO
and a molecular weight of 331.25 g/mol. Its IUPAC name is 5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran.
Molecular Properties
| Compound Name | 5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran |
| PubChem CID | 66759547 |
| Molecular Formula | C18H19BrO |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran |
| SMILES | Cc1ccc(-c2c(Br)cc3c(c2C)OC(C)(C)C3)cc1 |
| InChI | InChI=1S/C18H19BrO/c1-11-5-7-13(8-6-11)16-12(2)17-14(9-15(16)19)10-18(3,4)20-17/h5-9H,10H2,1-4H3 |
| InChIKey | PTXKPIXOPWWZCR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran?
The IUPAC name of 5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran (CID 66759547) is 5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran.
What is the SMILES notation for 5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran?
The canonical SMILES for 5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran is Cc1ccc(-c2c(Br)cc3c(c2C)OC(C)(C)C3)cc1.
What is the InChIKey of 5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran?
The InChIKey is PTXKPIXOPWWZCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19BrO/c1-11-5-7-13(8-6-11)16-12(2)17-14(9-15(16)19)10-18(3,4)20-17/h5-9H,10H2,1-4H3.
What are the key properties of 5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran?
5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran has a molecular weight of 331.25 g/mol, XLogP of 5.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,2,7-trimethyl-6-(4-methylphenyl)-3H-1-benzofuran is sourced from PubChem (CID 66759547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).