About 5,6-difluoro-1H-2,4,1-benzodioxazine
5,6-difluoro-1H-2,4,1-benzodioxazine (PubChem CID 66759615) has the molecular formula C7H5F2NO2
and a molecular weight of 173.12 g/mol. Its IUPAC name is 5,6-difluoro-1H-2,4,1-benzodioxazine.
Molecular Properties
| Compound Name | 5,6-difluoro-1H-2,4,1-benzodioxazine |
| PubChem CID | 66759615 |
| Molecular Formula | C7H5F2NO2 |
| Molecular Weight | 173.12 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | 5,6-difluoro-1H-2,4,1-benzodioxazine |
| SMILES | Fc1ccc2c(c1F)OCON2 |
| InChI | InChI=1S/C7H5F2NO2/c8-4-1-2-5-7(6(4)9)11-3-12-10-5/h1-2,10H,3H2 |
| InChIKey | SGTTURQCMNPYDY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.12 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-difluoro-1H-2,4,1-benzodioxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-difluoro-1H-2,4,1-benzodioxazine?
The IUPAC name of 5,6-difluoro-1H-2,4,1-benzodioxazine (CID 66759615) is 5,6-difluoro-1H-2,4,1-benzodioxazine.
What is the SMILES notation for 5,6-difluoro-1H-2,4,1-benzodioxazine?
The canonical SMILES for 5,6-difluoro-1H-2,4,1-benzodioxazine is Fc1ccc2c(c1F)OCON2.
What is the InChIKey of 5,6-difluoro-1H-2,4,1-benzodioxazine?
The InChIKey is SGTTURQCMNPYDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F2NO2/c8-4-1-2-5-7(6(4)9)11-3-12-10-5/h1-2,10H,3H2.
What are the key properties of 5,6-difluoro-1H-2,4,1-benzodioxazine?
5,6-difluoro-1H-2,4,1-benzodioxazine has a molecular weight of 173.12 g/mol, XLogP of 1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluoro-1H-2,4,1-benzodioxazine is sourced from PubChem (CID 66759615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).