About [2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride
[2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride (PubChem CID 66759897) has the molecular formula C10H19Cl2F3N4
and a molecular weight of 323.19 g/mol. Its IUPAC name is [2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride.
Molecular Properties
| Compound Name | [2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride |
| PubChem CID | 66759897 |
| Molecular Formula | C10H19Cl2F3N4 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride |
| SMILES | CCCCCCn1nc(C(F)(F)F)nc1CN.Cl.Cl |
| InChI | InChI=1S/C10H17F3N4.2ClH/c1-2-3-4-5-6-17-8(7-14)15-9(16-17)10(11,12)13;;/h2-7,14H2,1H3;2*1H |
| InChIKey | HOFLVXXNJBVWCU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride?
The IUPAC name of [2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride (CID 66759897) is [2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride.
What is the SMILES notation for [2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride?
The canonical SMILES for [2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride is CCCCCCn1nc(C(F)(F)F)nc1CN.Cl.Cl.
What is the InChIKey of [2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride?
The InChIKey is HOFLVXXNJBVWCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N4.2ClH/c1-2-3-4-5-6-17-8(7-14)15-9(16-17)10(11,12)13;;/h2-7,14H2,1H3;2*1H.
What are the key properties of [2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride?
[2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride has a molecular weight of 323.19 g/mol, XLogP of 3.18, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-hexyl-5-(trifluoromethyl)-1,2,4-triazol-3-yl]methanamine;dihydrochloride is sourced from PubChem (CID 66759897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).