About 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid
4-fluorothieno[2,3-c]pyridine-2-carboxylic acid (PubChem CID 66760717) has the molecular formula C8H4FNO2S
and a molecular weight of 197.19 g/mol. Its IUPAC name is 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid |
| PubChem CID | 66760717 |
| Molecular Formula | C8H4FNO2S |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 196.99 |
| IUPAC Name | 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(F)cncc2s1 |
| InChI | InChI=1S/C8H4FNO2S/c9-5-2-10-3-7-4(5)1-6(13-7)8(11)12/h1-3H,(H,11,12) |
| InChIKey | HKXMBOHBJLYPJD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid?
The IUPAC name of 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid (CID 66760717) is 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid.
What is the SMILES notation for 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid?
The canonical SMILES for 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid is O=C(O)c1cc2c(F)cncc2s1.
What is the InChIKey of 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid?
The InChIKey is HKXMBOHBJLYPJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4FNO2S/c9-5-2-10-3-7-4(5)1-6(13-7)8(11)12/h1-3H,(H,11,12).
What are the key properties of 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid?
4-fluorothieno[2,3-c]pyridine-2-carboxylic acid has a molecular weight of 197.19 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorothieno[2,3-c]pyridine-2-carboxylic acid is sourced from PubChem (CID 66760717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).