C33H45F4NO3Si — CID 66761396
tert-butyl-[(3S,9S)-3-[2-fluoro-4-(trifluoromethyl)phenyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane (PubChem CID 66761396) has the molecular formula C33H45F4NO3Si and a molecular weight of 607.81 g/mol. Its IUPAC name is tert-butyl-[(3S,9S)-3-[2-fluoro-4-(trifluoromethyl)phenyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,9S)-3-[2-fluoro-4-(trifluoromethyl)phenyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 66761396 |
| Molecular Formula | C33H45F4NO3Si |
| Molecular Weight | 607.81 g/mol |
| Exact Mass | 607.31 |
| IUPAC Name | tert-butyl-[(3S,9S)-3-[2-fluoro-4-(trifluoromethyl)phenyl]-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(F)(F)F)cc1F)OC31CCOCC1)[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)C2 |
| InChI | InChI=1S/C33H45F4NO3Si/c1-19(2)28-26-27(25-23(38-28)17-31(6,7)18-24(25)41-42(8,9)30(3,4)5)32(12-14-39-15-13-32)40-29(26)21-11-10-20(16-22(21)34)33(35,36)37/h10-11,16,19,24,29H,12-15,17-18H2,1-9H3/t24-,29+/m0/s1 |
| InChIKey | SATJMJQFILEPOU-PWUYWRBVSA-N |
| XLogP | 9.52 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.81 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|