C37H49F3N2O3Si — CID 66761415
5-[(3R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexyl-7,7-dimethylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-3-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 66761415) has the molecular formula C37H49F3N2O3Si and a molecular weight of 654.89 g/mol. Its IUPAC name is 5-[(3R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexyl-7,7-dimethylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-3-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 5-[(3R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexyl-7,7-dimethylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-3-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 66761415 |
| Molecular Formula | C37H49F3N2O3Si |
| Molecular Weight | 654.89 g/mol |
| Exact Mass | 654.35 |
| IUPAC Name | 5-[(3R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-4-cyclohexyl-7,7-dimethylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-3-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)Cc2nc(C3CCCCC3)c3c(c2[C@@H](O[Si](C)(C)C(C)(C)C)C1)C1(CCOCC1)O[C@@H]3c1ccc(C(F)(F)F)c(C#N)c1 |
| InChI | InChI=1S/C37H49F3N2O3Si/c1-34(2,3)46(6,7)45-28-21-35(4,5)20-27-29(28)31-30(32(42-27)23-11-9-8-10-12-23)33(44-36(31)15-17-43-18-16-36)24-13-14-26(37(38,39)40)25(19-24)22-41/h13-14,19,23,28,33H,8-12,15-18,20-21H2,1-7H3/t28-,33+/m0/s1 |
| InChIKey | UXNAYGYZYVIZMZ-QPQHGXMVSA-N |
| XLogP | 10.18 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.89 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|