About 2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide
2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide (PubChem CID 66761457) has the molecular formula C11H9FN2OS
and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide |
| PubChem CID | 66761457 |
| Molecular Formula | C11H9FN2OS |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide |
| SMILES | NC(=O)C(F)(c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C11H9FN2OS/c12-11(9(13)15,10-14-6-7-16-10)8-4-2-1-3-5-8/h1-7H,(H2,13,15) |
| InChIKey | KBSSIRCUDGJNHQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide?
The IUPAC name of 2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide (CID 66761457) is 2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for 2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide?
The canonical SMILES for 2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide is NC(=O)C(F)(c1ccccc1)c1nccs1.
What is the InChIKey of 2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide?
The InChIKey is KBSSIRCUDGJNHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2OS/c12-11(9(13)15,10-14-6-7-16-10)8-4-2-1-3-5-8/h1-7H,(H2,13,15).
What are the key properties of 2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide?
2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide has a molecular weight of 236.27 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-2-phenyl-2-(1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 66761457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).