C33H46F3NO2Si — CID 66761536
tert-butyl-[(3R,9S)-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane (PubChem CID 66761536) has the molecular formula C33H46F3NO2Si and a molecular weight of 573.82 g/mol. Its IUPAC name is tert-butyl-[(3R,9S)-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,9S)-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 66761536 |
| Molecular Formula | C33H46F3NO2Si |
| Molecular Weight | 573.82 g/mol |
| Exact Mass | 573.32 |
| IUPAC Name | tert-butyl-[(3R,9S)-7,7-dimethyl-4-propan-2-yl-3-[4-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(F)(F)F)cc1)OC31CCCC1)[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)C2 |
| InChI | InChI=1S/C33H46F3NO2Si/c1-20(2)28-26-27(25-23(37-28)18-31(6,7)19-24(25)39-40(8,9)30(3,4)5)32(16-10-11-17-32)38-29(26)21-12-14-22(15-13-21)33(34,35)36/h12-15,20,24,29H,10-11,16-19H2,1-9H3/t24-,29+/m0/s1 |
| InChIKey | GYMKVYQTNASWTM-PWUYWRBVSA-N |
| XLogP | 10.15 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.82 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|