C33H44F4INO3Si — CID 66761537
tert-butyl-[(3S,9S)-3-[2-fluoro-4-(trifluoromethyl)phenyl]-3'-iodo-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane (PubChem CID 66761537) has the molecular formula C33H44F4INO3Si and a molecular weight of 733.70 g/mol. Its IUPAC name is tert-butyl-[(3S,9S)-3-[2-fluoro-4-(trifluoromethyl)phenyl]-3'-iodo-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,9S)-3-[2-fluoro-4-(trifluoromethyl)phenyl]-3'-iodo-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 66761537 |
| Molecular Formula | C33H44F4INO3Si |
| Molecular Weight | 733.70 g/mol |
| Exact Mass | 733.21 |
| IUPAC Name | tert-butyl-[(3S,9S)-3-[2-fluoro-4-(trifluoromethyl)phenyl]-3'-iodo-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,4'-oxane]-9-yl]oxy-dimethylsilane |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(F)(F)F)cc1F)OC31CCOCC1I)[C@@H](O[Si](C)(C)C(C)(C)C)CC(C)(C)C2 |
| InChI | InChI=1S/C33H44F4INO3Si/c1-18(2)28-26-27(25-22(39-28)15-31(6,7)16-23(25)42-43(8,9)30(3,4)5)32(12-13-40-17-24(32)38)41-29(26)20-11-10-19(14-21(20)34)33(35,36)37/h10-11,14,18,23-24,29H,12-13,15-17H2,1-9H3/t23-,24?,29+,32?/m0/s1 |
| InChIKey | FMSRMDUOLFUOTB-HIMPFQPYSA-N |
| XLogP | 9.94 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.70 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|