C34H48FNO2Si — CID 66761585
tert-butyl-[(3R,9S)-4-cyclopentyl-3-(4-fluorophenyl)-7,7-dimethylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane (PubChem CID 66761585) has the molecular formula C34H48FNO2Si and a molecular weight of 549.85 g/mol. Its IUPAC name is tert-butyl-[(3R,9S)-4-cyclopentyl-3-(4-fluorophenyl)-7,7-dimethylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,9S)-4-cyclopentyl-3-(4-fluorophenyl)-7,7-dimethylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 66761585 |
| Molecular Formula | C34H48FNO2Si |
| Molecular Weight | 549.85 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | tert-butyl-[(3R,9S)-4-cyclopentyl-3-(4-fluorophenyl)-7,7-dimethylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane |
| SMILES | CC1(C)Cc2nc(C3CCCC3)c3c(c2[C@@H](O[Si](C)(C)C(C)(C)C)C1)C1(CCCC1)O[C@@H]3c1ccc(F)cc1 |
| InChI | InChI=1S/C34H48FNO2Si/c1-32(2,3)39(6,7)38-26-21-33(4,5)20-25-27(26)29-28(30(36-25)22-12-8-9-13-22)31(23-14-16-24(35)17-15-23)37-34(29)18-10-11-19-34/h14-17,22,26,31H,8-13,18-21H2,1-7H3/t26-,31+/m0/s1 |
| InChIKey | QFIJCGLGCJEXDK-SUYBVONHSA-N |
| XLogP | 9.80 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.85 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|