C31H31Cl4NO3 — CID 66761803
N-cyclopropyl-2-[[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]methyl]-N-[(2,3-dichlorophenyl)methyl]pent-4-enamide (PubChem CID 66761803) has the molecular formula C31H31Cl4NO3 and a molecular weight of 607.41 g/mol. Its IUPAC name is N-cyclopropyl-2-[[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]methyl]-N-[(2,3-dichlorophenyl)methyl]pent-4-enamide.
| Compound Name | N-cyclopropyl-2-[[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]methyl]-N-[(2,3-dichlorophenyl)methyl]pent-4-enamide |
|---|---|
| PubChem CID | 66761803 |
| Molecular Formula | C31H31Cl4NO3 |
| Molecular Weight | 607.41 g/mol |
| Exact Mass | 605.11 |
| IUPAC Name | N-cyclopropyl-2-[[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]methyl]-N-[(2,3-dichlorophenyl)methyl]pent-4-enamide |
| SMILES | C=CCC(Cc1ccc(OCCOc2c(Cl)cc(C)cc2Cl)cc1)C(=O)N(Cc1cccc(Cl)c1Cl)C1CC1 |
| InChI | InChI=1S/C31H31Cl4NO3/c1-3-5-22(31(37)36(24-10-11-24)19-23-6-4-7-26(32)29(23)35)18-21-8-12-25(13-9-21)38-14-15-39-30-27(33)16-20(2)17-28(30)34/h3-4,6-9,12-13,16-17,22,24H,1,5,10-11,14-15,18-19H2,2H3 |
| InChIKey | DRDGQXUAGZYOKI-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.41 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|