C9H15N5O — CID 66762052
N-ethyl-2-(1,4,8,9-tetrahydropurin-7-yl)acetamide (PubChem CID 66762052) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is N-ethyl-2-(1,4,8,9-tetrahydropurin-7-yl)acetamide.
| Compound Name | N-ethyl-2-(1,4,8,9-tetrahydropurin-7-yl)acetamide |
|---|---|
| PubChem CID | 66762052 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | N-ethyl-2-(1,4,8,9-tetrahydropurin-7-yl)acetamide |
| SMILES | CCNC(=O)CN1CNC2N=CNC=C21 |
| InChI | InChI=1S/C9H15N5O/c1-2-11-8(15)4-14-6-13-9-7(14)3-10-5-12-9/h3,5,9,13H,2,4,6H2,1H3,(H,10,12)(H,11,15) |
| InChIKey | QPISISKBLWSBMK-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |