C38H57NO2Si — CID 66762178
tert-butyl-[(3R,9S)-3-(3-tert-butylphenyl)-4-cyclopentyl-7,7-dimethylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane (PubChem CID 66762178) has the molecular formula C38H57NO2Si and a molecular weight of 587.97 g/mol. Its IUPAC name is tert-butyl-[(3R,9S)-3-(3-tert-butylphenyl)-4-cyclopentyl-7,7-dimethylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,9S)-3-(3-tert-butylphenyl)-4-cyclopentyl-7,7-dimethylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 66762178 |
| Molecular Formula | C38H57NO2Si |
| Molecular Weight | 587.97 g/mol |
| Exact Mass | 587.42 |
| IUPAC Name | tert-butyl-[(3R,9S)-3-(3-tert-butylphenyl)-4-cyclopentyl-7,7-dimethylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-yl]oxy-dimethylsilane |
| SMILES | CC1(C)Cc2nc(C3CCCC3)c3c(c2[C@@H](O[Si](C)(C)C(C)(C)C)C1)C1(CCCC1)O[C@@H]3c1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H57NO2Si/c1-35(2,3)27-19-15-18-26(22-27)34-31-32(38(40-34)20-13-14-21-38)30-28(39-33(31)25-16-11-12-17-25)23-37(7,8)24-29(30)41-42(9,10)36(4,5)6/h15,18-19,22,25,29,34H,11-14,16-17,20-21,23-24H2,1-10H3/t29-,34+/m0/s1 |
| InChIKey | AWQVMTZGXHDPPN-ZBWWXOROSA-N |
| XLogP | 10.96 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.97 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|