C13H21BN2O4 — CID 66762411
3-(1,3-dioxolan-4-yl)-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 66762411) has the molecular formula C13H21BN2O4 and a molecular weight of 280.13 g/mol. Its IUPAC name is 3-(1,3-dioxolan-4-yl)-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 3-(1,3-dioxolan-4-yl)-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 66762411 |
| Molecular Formula | C13H21BN2O4 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-(1,3-dioxolan-4-yl)-1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cn1cc(B2OC(C)(C)C(C)(C)O2)c(C2COCO2)n1 |
| InChI | InChI=1S/C13H21BN2O4/c1-12(2)13(3,4)20-14(19-12)9-6-16(5)15-11(9)10-7-17-8-18-10/h6,10H,7-8H2,1-5H3 |
| InChIKey | OKGITHNKKWRDII-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|