About 5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one
5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one (PubChem CID 66762480) has the molecular formula C18H18O4
and a molecular weight of 298.34 g/mol. Its IUPAC name is 5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one.
Molecular Properties
| Compound Name | 5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one |
| PubChem CID | 66762480 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one |
| SMILES | COc1c(C)c(O)c2c(c1C)OC(c1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C18H18O4/c1-10-15(20)13-9-14(19)18(12-7-5-4-6-8-12)22-17(13)11(2)16(10)21-3/h4-8,18,20H,9H2,1-3H3 |
| InChIKey | KXNWTMADLBYFCK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one?
The IUPAC name of 5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one (CID 66762480) is 5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one.
What is the SMILES notation for 5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one?
The canonical SMILES for 5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one is COc1c(C)c(O)c2c(c1C)OC(c1ccccc1)C(=O)C2.
What is the InChIKey of 5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one?
The InChIKey is KXNWTMADLBYFCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O4/c1-10-15(20)13-9-14(19)18(12-7-5-4-6-8-12)22-17(13)11(2)16(10)21-3/h4-8,18,20H,9H2,1-3H3.
What are the key properties of 5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one?
5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one has a molecular weight of 298.34 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-chromen-3-one is sourced from PubChem (CID 66762480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).