C15H19NO6 — CID 66762718
[(1R,2S,3R,4R,5R)-3,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] N-(3,5-dimethylphenyl)carbamate (PubChem CID 66762718) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is [(1R,2S,3R,4R,5R)-3,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] N-(3,5-dimethylphenyl)carbamate.
| Compound Name | [(1R,2S,3R,4R,5R)-3,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] N-(3,5-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 66762718 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | [(1R,2S,3R,4R,5R)-3,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] N-(3,5-dimethylphenyl)carbamate |
| SMILES | Cc1cc(C)cc(NC(=O)O[C@H]2[C@H](O)[C@@H](O)[C@@H]3OC[C@H]2O3)c1 |
| InChI | InChI=1S/C15H19NO6/c1-7-3-8(2)5-9(4-7)16-15(19)22-13-10-6-20-14(21-10)12(18)11(13)17/h3-5,10-14,17-18H,6H2,1-2H3,(H,16,19)/t10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | QMZWAFJMSATBMO-DHGKCCLASA-N |
| XLogP | 0.70 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |