C32H43NO4 — CID 66762992
2-[(3R,6R,9S)-3-(4-tert-butylphenyl)-9-hydroxy-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6-yl]acetic acid (PubChem CID 66762992) has the molecular formula C32H43NO4 and a molecular weight of 505.70 g/mol. Its IUPAC name is 2-[(3R,6R,9S)-3-(4-tert-butylphenyl)-9-hydroxy-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6-yl]acetic acid.
| Compound Name | 2-[(3R,6R,9S)-3-(4-tert-butylphenyl)-9-hydroxy-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6-yl]acetic acid |
|---|---|
| PubChem CID | 66762992 |
| Molecular Formula | C32H43NO4 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 2-[(3R,6R,9S)-3-(4-tert-butylphenyl)-9-hydroxy-7,7-dimethyl-4-propan-2-ylspiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-6-yl]acetic acid |
| SMILES | CC(C)c1nc2c(c3c1[C@@H](c1ccc(C(C)(C)C)cc1)OC31CCCC1)[C@@H](O)CC(C)(C)[C@H]2CC(=O)O |
| InChI | InChI=1S/C32H43NO4/c1-18(2)27-25-26(24-22(34)17-31(6,7)21(16-23(35)36)28(24)33-27)32(14-8-9-15-32)37-29(25)19-10-12-20(13-11-19)30(3,4)5/h10-13,18,21-22,29,34H,8-9,14-17H2,1-7H3,(H,35,36)/t21-,22-,29+/m0/s1 |
| InChIKey | CYYSXOMXGLLIFC-IHMCZWCLSA-N |
| XLogP | 7.41 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |