C18H15N3O3 — CID 66763204
4-(1,3-benzodioxol-5-ylmethylamino)quinoline-8-carboxamide (PubChem CID 66763204) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethylamino)quinoline-8-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethylamino)quinoline-8-carboxamide |
|---|---|
| PubChem CID | 66763204 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethylamino)quinoline-8-carboxamide |
| SMILES | NC(=O)c1cccc2c(NCc3ccc4c(c3)OCO4)ccnc12 |
| InChI | InChI=1S/C18H15N3O3/c19-18(22)13-3-1-2-12-14(6-7-20-17(12)13)21-9-11-4-5-15-16(8-11)24-10-23-15/h1-8H,9-10H2,(H2,19,22)(H,20,21) |
| InChIKey | IUJLVKHXNQQZGT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |