C22H19N5O3 — CID 66763376
4-[1-[3-(furan-3-carbonylamino)phenyl]ethylamino]quinazoline-8-carboxamide (PubChem CID 66763376) has the molecular formula C22H19N5O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is 4-[1-[3-(furan-3-carbonylamino)phenyl]ethylamino]quinazoline-8-carboxamide.
| Compound Name | 4-[1-[3-(furan-3-carbonylamino)phenyl]ethylamino]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 66763376 |
| Molecular Formula | C22H19N5O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | 4-[1-[3-(furan-3-carbonylamino)phenyl]ethylamino]quinazoline-8-carboxamide |
| SMILES | CC(Nc1ncnc2c(C(N)=O)cccc12)c1cccc(NC(=O)c2ccoc2)c1 |
| InChI | InChI=1S/C22H19N5O3/c1-13(14-4-2-5-16(10-14)27-22(29)15-8-9-30-11-15)26-21-18-7-3-6-17(20(23)28)19(18)24-12-25-21/h2-13H,1H3,(H2,23,28)(H,27,29)(H,24,25,26) |
| InChIKey | OIHRDLGLZDFHAD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |