About ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate
ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate (PubChem CID 66763795) has the molecular formula C23H22N6O4
and a molecular weight of 446.47 g/mol. Its IUPAC name is ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate |
| PubChem CID | 66763795 |
| Molecular Formula | C23H22N6O4 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2cccc(C(C)Nc3ncnc4c(C(N)=O)cccc34)c2)o1 |
| InChI | InChI=1S/C23H22N6O4/c1-3-32-22(31)18-11-25-23(33-18)29-15-7-4-6-14(10-15)13(2)28-21-17-9-5-8-16(20(24)30)19(17)26-12-27-21/h4-13H,3H2,1-2H3,(H2,24,30)(H,25,29)(H,26,27,28) |
| InChIKey | ASCRXOPBUNVSNJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate?
The IUPAC name of ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate (CID 66763795) is ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate?
The canonical SMILES for ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate is CCOC(=O)c1cnc(Nc2cccc(C(C)Nc3ncnc4c(C(N)=O)cccc34)c2)o1.
What is the InChIKey of ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate?
The InChIKey is ASCRXOPBUNVSNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N6O4/c1-3-32-22(31)18-11-25-23(33-18)29-15-7-4-6-14(10-15)13(2)28-21-17-9-5-8-16(20(24)30)19(17)26-12-27-21/h4-13H,3H2,1-2H3,(H2,24,30)(H,25,29)(H,26,27,28).
What are the key properties of ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate?
ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate has a molecular weight of 446.47 g/mol, XLogP of 3.81, 8 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3-[1-[(8-carbamoylquinazolin-4-yl)amino]ethyl]anilino]-1,3-oxazole-5-carboxylate is sourced from PubChem (CID 66763795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).