C5H9N3O — CID 66764519
1,2,3,4-tetrahydropyrimidine-4-carboxamide (PubChem CID 66764519) has the molecular formula C5H9N3O and a molecular weight of 127.15 g/mol. Its IUPAC name is 1,2,3,4-tetrahydropyrimidine-4-carboxamide.
| Compound Name | 1,2,3,4-tetrahydropyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 66764519 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 1,2,3,4-tetrahydropyrimidine-4-carboxamide |
| SMILES | NC(=O)C1C=CNCN1 |
| InChI | InChI=1S/C5H9N3O/c6-5(9)4-1-2-7-3-8-4/h1-2,4,7-8H,3H2,(H2,6,9) |
| InChIKey | KIEKMCYRHCZJLI-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |