C25H36N2O4 — CID 66764673
2,3-dimethoxy-5-methyl-6-[10-[methyl(pyridin-2-yl)amino]decyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 66764673) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[10-[methyl(pyridin-2-yl)amino]decyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[10-[methyl(pyridin-2-yl)amino]decyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 66764673 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[10-[methyl(pyridin-2-yl)amino]decyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCCCN(C)c2ccccn2)=C(C)C1=O |
| InChI | InChI=1S/C25H36N2O4/c1-19-20(23(29)25(31-4)24(30-3)22(19)28)15-11-9-7-5-6-8-10-14-18-27(2)21-16-12-13-17-26-21/h12-13,16-17H,5-11,14-15,18H2,1-4H3 |
| InChIKey | UVRRDPHNMVHOGD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|