C12H15ClN2O3 — CID 66765017
N-[(4-chloro-3-nitrophenyl)methyl]-2,2-dimethylpropanamide (PubChem CID 66765017) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is N-[(4-chloro-3-nitrophenyl)methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(4-chloro-3-nitrophenyl)methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 66765017 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-[(4-chloro-3-nitrophenyl)methyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15ClN2O3/c1-12(2,3)11(16)14-7-8-4-5-9(13)10(6-8)15(17)18/h4-6H,7H2,1-3H3,(H,14,16) |
| InChIKey | JDVIUBIEWLWZJW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|