About 9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole
9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole (PubChem CID 66765908) has the molecular formula C25H19ClN2O2S
and a molecular weight of 446.96 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole |
| PubChem CID | 66765908 |
| Molecular Formula | C25H19ClN2O2S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole |
| SMILES | O=S(=O)(c1ccccc1)n1c2ccc(C#CC3=CCCCC3)cc2c2c(Cl)ccnc21 |
| InChI | InChI=1S/C25H19ClN2O2S/c26-22-15-16-27-25-24(22)21-17-19(12-11-18-7-3-1-4-8-18)13-14-23(21)28(25)31(29,30)20-9-5-2-6-10-20/h2,5-7,9-10,13-17H,1,3-4,8H2 |
| InChIKey | UWLSYBKGKXVJLE-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole?
The IUPAC name of 9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole (CID 66765908) is 9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole.
What is the SMILES notation for 9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole?
The canonical SMILES for 9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole is O=S(=O)(c1ccccc1)n1c2ccc(C#CC3=CCCCC3)cc2c2c(Cl)ccnc21.
What is the InChIKey of 9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole?
The InChIKey is UWLSYBKGKXVJLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19ClN2O2S/c26-22-15-16-27-25-24(22)21-17-19(12-11-18-7-3-1-4-8-18)13-14-23(21)28(25)31(29,30)20-9-5-2-6-10-20/h2,5-7,9-10,13-17H,1,3-4,8H2.
What are the key properties of 9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole?
9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole has a molecular weight of 446.96 g/mol, XLogP of 5.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(benzenesulfonyl)-4-chloro-6-[2-(cyclohexen-1-yl)ethynyl]pyrido[2,3-b]indole is sourced from PubChem (CID 66765908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).