About 9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole
9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole (PubChem CID 66765950) has the molecular formula C33H22F2N2O2S
and a molecular weight of 548.61 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole |
| PubChem CID | 66765950 |
| Molecular Formula | C33H22F2N2O2S |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole |
| SMILES | O=S(=O)(c1ccccc1)n1c2ccc(C=Cc3cccc(F)c3)cc2c2c(C=Cc3cccc(F)c3)ccnc21 |
| InChI | InChI=1S/C33H22F2N2O2S/c34-27-8-4-6-23(20-27)12-13-25-15-17-31-30(22-25)32-26(16-14-24-7-5-9-28(35)21-24)18-19-36-33(32)37(31)40(38,39)29-10-2-1-3-11-29/h1-22H |
| InChIKey | HERYKDPRAGHYFB-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole?
The IUPAC name of 9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole (CID 66765950) is 9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole.
What is the SMILES notation for 9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole?
The canonical SMILES for 9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole is O=S(=O)(c1ccccc1)n1c2ccc(C=Cc3cccc(F)c3)cc2c2c(C=Cc3cccc(F)c3)ccnc21.
What is the InChIKey of 9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole?
The InChIKey is HERYKDPRAGHYFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H22F2N2O2S/c34-27-8-4-6-23(20-27)12-13-25-15-17-31-30(22-25)32-26(16-14-24-7-5-9-28(35)21-24)18-19-36-33(32)37(31)40(38,39)29-10-2-1-3-11-29/h1-22H.
What are the key properties of 9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole?
9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole has a molecular weight of 548.61 g/mol, XLogP of 8.05, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(benzenesulfonyl)-4,6-bis[2-(3-fluorophenyl)ethenyl]pyrido[2,3-b]indole is sourced from PubChem (CID 66765950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).