About 9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole
9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole (PubChem CID 66766037) has the molecular formula C22H17ClN2O2S
and a molecular weight of 408.91 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole |
| PubChem CID | 66766037 |
| Molecular Formula | C22H17ClN2O2S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole |
| SMILES | CCCC#Cc1ccc2c(c1)c1cc(Cl)cnc1n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H17ClN2O2S/c1-2-3-5-8-16-11-12-21-19(13-16)20-14-17(23)15-24-22(20)25(21)28(26,27)18-9-6-4-7-10-18/h4,6-7,9-15H,2-3H2,1H3 |
| InChIKey | QMHDRTOIIBIGQP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole?
The IUPAC name of 9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole (CID 66766037) is 9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole.
What is the SMILES notation for 9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole?
The canonical SMILES for 9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole is CCCC#Cc1ccc2c(c1)c1cc(Cl)cnc1n2S(=O)(=O)c1ccccc1.
What is the InChIKey of 9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole?
The InChIKey is QMHDRTOIIBIGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17ClN2O2S/c1-2-3-5-8-16-11-12-21-19(13-16)20-14-17(23)15-24-22(20)25(21)28(26,27)18-9-6-4-7-10-18/h4,6-7,9-15H,2-3H2,1H3.
What are the key properties of 9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole?
9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole has a molecular weight of 408.91 g/mol, XLogP of 5.23, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(benzenesulfonyl)-3-chloro-6-pent-1-ynylpyrido[2,3-b]indole is sourced from PubChem (CID 66766037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).